Produits intermédiaires industriels en vrac 5449-12-7 XZZ00XZ

CAS Registry Number: 5449-12-7Benzenesulfonamide, 4-methoxy-N-(tributylstannyl)-
Benzenesulfonamide, 4-methoxy-N-(tributylstannyl)-
Product Name: BMK Sodium Glycidate
English Name: BMK glycidic acid sodium
Alias: BMK powder; 2-methyl-3-phenyloxirane-2-carboxylic acid sodium
Molecular Structure: Sodium 2,3-dihydroxybenzoate (CAS 5449-12-7) Molecular Structure
Molecular Formula: C10H10NaO3+
Molecular Weight: 201.17

Molecular Line Input Code: SMILES CC1(C(O1)C2=CC=CC=C2)C(=O)O.[Na+]
Sodium BMK lactone, also known as sodium γ-butyrolactone ethylene oxide acid, was discovered through research in the fields of organic chemistry and chemical synthesis. It is synthesized by the reaction of γ-butyrolactone with ethylene oxide, followed by neutralization with sodium hydroxide to form a sodium salt. This compound was first reported in scientific literature at the end of the 20th century, and its structure was confirmed through spectral analysis and chemical identification. The discovery of sodium BMK lactone contributes to understanding its chemical properties and potential applications in various industries.
Sodium BMK cyclohexane carboxylate is a key intermediate in drug synthesis. It participates in chemical reactions to form complex organic molecules with potential pharmacological activity and is typically used in the production of anti-inflammatory drugs, antiepileptic drugs, and cardiovascular drugs, among others.
This compound serves as the foundation for the synthesis of various organic compounds in chemical research. Chemists use sodium BMK sugar ring acid as a precursor to prepare substituted lactones, carboxylic acids, and esters through multiple chemical reactions. Its multi-functional reactivity enables the creation of structurally diverse molecules for the exploration of new materials and bioactivity.
Sodium BMK tartrate is used in the production of industrial chemicals and specialty compounds. It serves as a starting material for the synthesis of surfactants, plasticizers, and fine chemicals in various industrial processes. It participates in chemical reactions, and the resulting products are utilized in the coatings, adhesives, and polymer industries.
This compound can be used in the synthesis of pesticides, such as insecticides and herbicides. As an intermediate of the active ingredient, it is used to control pests, weeds and fungal diseases in agricultural environments. Its role in the synthesis of pesticides helps increase crop yields and protect crops from pests and diseases.
Sodium BMK terephthalate is used in materials science for the synthesis of polymers, resins and specialty materials. It participates in polymerization reactions to produce polymers with specific properties such as flexibility, durability and thermal stability. These polymers are widely used in various industries including automotive, construction and electronics.